C18H26N2O4 — CID 69358675
2-[4-(oxan-2-yloxy)butoxy]-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one (PubChem CID 69358675) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[4-(oxan-2-yloxy)butoxy]-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one.
| Compound Name | 2-[4-(oxan-2-yloxy)butoxy]-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one |
|---|---|
| PubChem CID | 69358675 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-[4-(oxan-2-yloxy)butoxy]-5,6,7,9-tetrahydropyrido[2,3-b]azepin-8-one |
| SMILES | O=C1CCCc2ccc(OCCCCOC3CCCCO3)nc2N1 |
| InChI | InChI=1S/C18H26N2O4/c21-15-7-5-6-14-9-10-16(20-18(14)19-15)22-11-3-4-13-24-17-8-1-2-12-23-17/h9-10,17H,1-8,11-13H2,(H,19,20,21) |
| InChIKey | FEPQEOHQRHPLBI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|