C15H21F2N3O — CID 69358991
(9R,13R)-4-(difluoromethyl)-5-(ethoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene (PubChem CID 69358991) has the molecular formula C15H21F2N3O and a molecular weight of 297.35 g/mol. Its IUPAC name is (9R,13R)-4-(difluoromethyl)-5-(ethoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene.
| Compound Name | (9R,13R)-4-(difluoromethyl)-5-(ethoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 69358991 |
| Molecular Formula | C15H21F2N3O |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (9R,13R)-4-(difluoromethyl)-5-(ethoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene |
| SMILES | CCOCc1cc2c(nc1C(F)F)N1[C@@H](CNC[C@H]1C)C2 |
| InChI | InChI=1S/C15H21F2N3O/c1-3-21-8-11-4-10-5-12-7-18-6-9(2)20(12)15(10)19-13(11)14(16)17/h4,9,12,14,18H,3,5-8H2,1-2H3/t9-,12-/m1/s1 |
| InChIKey | OWOLPDXHDQNMPC-BXKDBHETSA-N |
| XLogP | 2.28 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |