C17H23F2N3O — CID 69359502
(9R,13R)-5-(cyclopropylmethoxymethyl)-4-(difluoromethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene (PubChem CID 69359502) has the molecular formula C17H23F2N3O and a molecular weight of 323.39 g/mol. Its IUPAC name is (9R,13R)-5-(cyclopropylmethoxymethyl)-4-(difluoromethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene.
| Compound Name | (9R,13R)-5-(cyclopropylmethoxymethyl)-4-(difluoromethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 69359502 |
| Molecular Formula | C17H23F2N3O |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | (9R,13R)-5-(cyclopropylmethoxymethyl)-4-(difluoromethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene |
| SMILES | C[C@@H]1CNC[C@H]2Cc3cc(COCC4CC4)c(C(F)F)nc3N21 |
| InChI | InChI=1S/C17H23F2N3O/c1-10-6-20-7-14-5-12-4-13(9-23-8-11-2-3-11)15(16(18)19)21-17(12)22(10)14/h4,10-11,14,16,20H,2-3,5-9H2,1H3/t10-,14-/m1/s1 |
| InChIKey | AQDGFPXOURYYHN-QMTHXVAHSA-N |
| XLogP | 2.67 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |