C15H21NO4S — CID 69361127
3-(1,1-dihydroxy-6,7-dihydro-3H-thiazepin-2-yl)-5-propylbenzoic acid (PubChem CID 69361127) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 3-(1,1-dihydroxy-6,7-dihydro-3H-thiazepin-2-yl)-5-propylbenzoic acid.
| Compound Name | 3-(1,1-dihydroxy-6,7-dihydro-3H-thiazepin-2-yl)-5-propylbenzoic acid |
|---|---|
| PubChem CID | 69361127 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3-(1,1-dihydroxy-6,7-dihydro-3H-thiazepin-2-yl)-5-propylbenzoic acid |
| SMILES | CCCc1cc(C(=O)O)cc(N2CC=CCCS2(O)O)c1 |
| InChI | InChI=1S/C15H21NO4S/c1-2-6-12-9-13(15(17)18)11-14(10-12)16-7-4-3-5-8-21(16,19)20/h3-4,9-11,19-20H,2,5-8H2,1H3,(H,17,18) |
| InChIKey | RKMBKLGCZAZBDY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|