C10H13F3N4 — CID 69361153
8-(cyclopropylmethyl)-2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 69361153) has the molecular formula C10H13F3N4 and a molecular weight of 246.24 g/mol. Its IUPAC name is 8-(cyclopropylmethyl)-2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 8-(cyclopropylmethyl)-2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 69361153 |
| Molecular Formula | C10H13F3N4 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 8-(cyclopropylmethyl)-2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | FC(F)(F)c1nc2n(n1)CCNC2CC1CC1 |
| InChI | InChI=1S/C10H13F3N4/c11-10(12,13)9-15-8-7(5-6-1-2-6)14-3-4-17(8)16-9/h6-7,14H,1-5H2 |
| InChIKey | NJNLTNVPCKXESQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |