C19H21FO2 — CID 69361381
(3E,4aS,8S)-3-[(2-fluorophenyl)methylidene]-8-hydroxy-1,4a-dimethyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 69361381) has the molecular formula C19H21FO2 and a molecular weight of 300.37 g/mol. Its IUPAC name is (3E,4aS,8S)-3-[(2-fluorophenyl)methylidene]-8-hydroxy-1,4a-dimethyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (3E,4aS,8S)-3-[(2-fluorophenyl)methylidene]-8-hydroxy-1,4a-dimethyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 69361381 |
| Molecular Formula | C19H21FO2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (3E,4aS,8S)-3-[(2-fluorophenyl)methylidene]-8-hydroxy-1,4a-dimethyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | CC1=C2[C@@H](O)CCC[C@@]2(C)C/C(=C\c2ccccc2F)C1=O |
| InChI | InChI=1S/C19H21FO2/c1-12-17-16(21)8-5-9-19(17,2)11-14(18(12)22)10-13-6-3-4-7-15(13)20/h3-4,6-7,10,16,21H,5,8-9,11H2,1-2H3/b14-10+/t16-,19-/m0/s1 |
| InChIKey | DBZXLCWPDFFCEE-UEAZWZDRSA-N |
| XLogP | 4.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|