C37H59NO5Si2 — CID 69362159
(4R)-3-[(2R,3S,4S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylpentanoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 69362159) has the molecular formula C37H59NO5Si2 and a molecular weight of 654.05 g/mol. Its IUPAC name is (4R)-3-[(2R,3S,4S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylpentanoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2R,3S,4S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylpentanoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69362159 |
| Molecular Formula | C37H59NO5Si2 |
| Molecular Weight | 654.05 g/mol |
| Exact Mass | 653.39 |
| IUPAC Name | (4R)-3-[(2R,3S,4S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylpentanoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1N(C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C)C(=O)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H59NO5Si2/c1-26(2)32-37(29-21-17-15-18-22-29,30-23-19-16-20-24-30)42-34(40)38(32)33(39)28(4)31(43-45(13,14)36(8,9)10)27(3)25-41-44(11,12)35(5,6)7/h15-24,26-28,31-32H,25H2,1-14H3/t27-,28+,31-,32+/m0/s1 |
| InChIKey | BZUGMSCQRQALLM-PDIPVHSCSA-N |
| XLogP | 9.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.05 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|