About 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine
3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine (PubChem CID 69362924) has the molecular formula C7H9F2N
and a molecular weight of 145.15 g/mol. Its IUPAC name is 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 69362924 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine |
| SMILES | CC1(F)C=CC(F)=CC1N |
| InChI | InChI=1S/C7H9F2N/c1-7(9)3-2-5(8)4-6(7)10/h2-4,6H,10H2,1H3 |
| InChIKey | QDYQFAMSRIDZHX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine (CID 69362924) is 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine is CC1(F)C=CC(F)=CC1N.
What is the InChIKey of 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine?
The InChIKey is QDYQFAMSRIDZHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2N/c1-7(9)3-2-5(8)4-6(7)10/h2-4,6H,10H2,1H3.
What are the key properties of 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine?
3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine has a molecular weight of 145.15 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-difluoro-6-methylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 69362924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).