About methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate
methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate (PubChem CID 69362978) has the molecular formula C13H9NO3
and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate |
| PubChem CID | 69362978 |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc2c(cn1)oc1ccccc12 |
| InChI | InChI=1S/C13H9NO3/c1-16-13(15)10-6-9-8-4-2-3-5-11(8)17-12(9)7-14-10/h2-7H,1H3 |
| InChIKey | DIKKPEZZPGHPSY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate?
The IUPAC name of methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate (CID 69362978) is methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate.
What is the SMILES notation for methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate?
The canonical SMILES for methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate is COC(=O)c1cc2c(cn1)oc1ccccc12.
What is the InChIKey of methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate?
The InChIKey is DIKKPEZZPGHPSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3/c1-16-13(15)10-6-9-8-4-2-3-5-11(8)17-12(9)7-14-10/h2-7H,1H3.
What are the key properties of methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate?
methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate has a molecular weight of 227.22 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [1]benzofuro[2,3-c]pyridine-3-carboxylate is sourced from PubChem (CID 69362978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).