C9H10F4N6O — CID 69363085
[1-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]-[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 69363085) has the molecular formula C9H10F4N6O and a molecular weight of 294.21 g/mol. Its IUPAC name is [1-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]-[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol.
| Compound Name | [1-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]-[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 69363085 |
| Molecular Formula | C9H10F4N6O |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | [1-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]-[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol |
| SMILES | OC(c1ncn(CC(F)F)n1)c1ncnn1CC(F)F |
| InChI | InChI=1S/C9H10F4N6O/c10-5(11)1-18-4-15-8(17-18)7(20)9-14-3-16-19(9)2-6(12)13/h3-7,20H,1-2H2 |
| InChIKey | IILCGZLJNMJQPD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |