C25H31NO5 — CID 69363114
(4R)-3-[(2R,3S,4S)-3,5-dihydroxy-2,4-dimethylpentanoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 69363114) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is (4R)-3-[(2R,3S,4S)-3,5-dihydroxy-2,4-dimethylpentanoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2R,3S,4S)-3,5-dihydroxy-2,4-dimethylpentanoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69363114 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (4R)-3-[(2R,3S,4S)-3,5-dihydroxy-2,4-dimethylpentanoyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1N(C(=O)[C@H](C)[C@@H](O)[C@@H](C)CO)C(=O)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31NO5/c1-16(2)22-25(19-11-7-5-8-12-19,20-13-9-6-10-14-20)31-24(30)26(22)23(29)18(4)21(28)17(3)15-27/h5-14,16-18,21-22,27-28H,15H2,1-4H3/t17-,18+,21-,22+/m0/s1 |
| InChIKey | FKRWFZDLMCKDQK-GKJHBJHPSA-N |
| XLogP | 3.56 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |