About [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid
[6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid (PubChem CID 69363377) has the molecular formula C20H29N3O4
and a molecular weight of 375.47 g/mol. Its IUPAC name is [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid.
Molecular Properties
| Compound Name | [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid |
| PubChem CID | 69363377 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid |
| SMILES | CCCCOc1c(N(C)C(=O)O)n(CC(C)(C)C)c(=O)c2ccc(N)cc12 |
| InChI | InChI=1S/C20H29N3O4/c1-6-7-10-27-16-15-11-13(21)8-9-14(15)18(24)23(12-20(2,3)4)17(16)22(5)19(25)26/h8-9,11H,6-7,10,12,21H2,1-5H3,(H,25,26) |
| InChIKey | SMMXPJIKECIJEB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid?
The IUPAC name of [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid (CID 69363377) is [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid.
What is the SMILES notation for [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid?
The canonical SMILES for [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid is CCCCOc1c(N(C)C(=O)O)n(CC(C)(C)C)c(=O)c2ccc(N)cc12.
What is the InChIKey of [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid?
The InChIKey is SMMXPJIKECIJEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N3O4/c1-6-7-10-27-16-15-11-13(21)8-9-14(15)18(24)23(12-20(2,3)4)17(16)22(5)19(25)26/h8-9,11H,6-7,10,12,21H2,1-5H3,(H,25,26).
What are the key properties of [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid?
[6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid has a molecular weight of 375.47 g/mol, XLogP of 3.92, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-amino-4-butoxy-2-(2,2-dimethylpropyl)-1-oxoisoquinolin-3-yl]-methylcarbamic acid is sourced from PubChem (CID 69363377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).