C10H13F3N4O — CID 69363535
cyclopropyl-[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]methanol (PubChem CID 69363535) has the molecular formula C10H13F3N4O and a molecular weight of 262.23 g/mol. Its IUPAC name is cyclopropyl-[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]methanol.
| Compound Name | cyclopropyl-[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]methanol |
|---|---|
| PubChem CID | 69363535 |
| Molecular Formula | C10H13F3N4O |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | cyclopropyl-[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]methanol |
| SMILES | OC(C1CC1)C1NCCn2nc(C(F)(F)F)nc21 |
| InChI | InChI=1S/C10H13F3N4O/c11-10(12,13)9-15-8-6(7(18)5-1-2-5)14-3-4-17(8)16-9/h5-7,14,18H,1-4H2 |
| InChIKey | OXRBLILGMBZFSW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |