About [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid
[4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid (PubChem CID 69363736) has the molecular formula C23H34N2O5
and a molecular weight of 418.53 g/mol. Its IUPAC name is [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid.
Molecular Properties
| Compound Name | [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid |
| PubChem CID | 69363736 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid |
| SMILES | CCCCOc1c(N(C)C(=O)O)n(CC(C)(C)C)c(=O)c2ccc(OCCC)cc12 |
| InChI | InChI=1S/C23H34N2O5/c1-7-9-13-30-19-18-14-16(29-12-8-2)10-11-17(18)21(26)25(15-23(3,4)5)20(19)24(6)22(27)28/h10-11,14H,7-9,12-13,15H2,1-6H3,(H,27,28) |
| InChIKey | UEWCTLYVMJKCNE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid?
The IUPAC name of [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid (CID 69363736) is [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid.
What is the SMILES notation for [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid?
The canonical SMILES for [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid is CCCCOc1c(N(C)C(=O)O)n(CC(C)(C)C)c(=O)c2ccc(OCCC)cc12.
What is the InChIKey of [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid?
The InChIKey is UEWCTLYVMJKCNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34N2O5/c1-7-9-13-30-19-18-14-16(29-12-8-2)10-11-17(18)21(26)25(15-23(3,4)5)20(19)24(6)22(27)28/h10-11,14H,7-9,12-13,15H2,1-6H3,(H,27,28).
What are the key properties of [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid?
[4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid has a molecular weight of 418.53 g/mol, XLogP of 5.13, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-butoxy-2-(2,2-dimethylpropyl)-1-oxo-6-propoxyisoquinolin-3-yl]-methylcarbamic acid is sourced from PubChem (CID 69363736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).