C8H9NO4 — CID 69364491
4,7-dihydroxy-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 69364491) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 4,7-dihydroxy-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 4,7-dihydroxy-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 69364491 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 4,7-dihydroxy-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1NC(=O)C2C(O)C=CC(O)C12 |
| InChI | InChI=1S/C8H9NO4/c10-3-1-2-4(11)6-5(3)7(12)9-8(6)13/h1-6,10-11H,(H,9,12,13) |
| InChIKey | RFPHHAPDVLOTMX-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|