C10H14F3N5O — CID 69364521
N,N-dimethyl-2-[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]acetamide (PubChem CID 69364521) has the molecular formula C10H14F3N5O and a molecular weight of 277.25 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]acetamide |
|---|---|
| PubChem CID | 69364521 |
| Molecular Formula | C10H14F3N5O |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N,N-dimethyl-2-[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]acetamide |
| SMILES | CN(C)C(=O)CC1NCCn2nc(C(F)(F)F)nc21 |
| InChI | InChI=1S/C10H14F3N5O/c1-17(2)7(19)5-6-8-15-9(10(11,12)13)16-18(8)4-3-14-6/h6,14H,3-5H2,1-2H3 |
| InChIKey | RHIXSXUMGCEEMO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |