C11H13F5O4 — CID 69364705
1,1,1,3,3-pentafluoro-3-(6-hydroxy-3,4a,5,7,8,8a-hexahydro-2H-benzo[b][1,4]dioxin-6-yl)propan-2-one (PubChem CID 69364705) has the molecular formula C11H13F5O4 and a molecular weight of 304.21 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-3-(6-hydroxy-3,4a,5,7,8,8a-hexahydro-2H-benzo[b][1,4]dioxin-6-yl)propan-2-one.
| Compound Name | 1,1,1,3,3-pentafluoro-3-(6-hydroxy-3,4a,5,7,8,8a-hexahydro-2H-benzo[b][1,4]dioxin-6-yl)propan-2-one |
|---|---|
| PubChem CID | 69364705 |
| Molecular Formula | C11H13F5O4 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-3-(6-hydroxy-3,4a,5,7,8,8a-hexahydro-2H-benzo[b][1,4]dioxin-6-yl)propan-2-one |
| SMILES | O=C(C(F)(F)F)C(F)(F)C1(O)CCC2OCCOC2C1 |
| InChI | InChI=1S/C11H13F5O4/c12-10(13,8(17)11(14,15)16)9(18)2-1-6-7(5-9)20-4-3-19-6/h6-7,18H,1-5H2 |
| InChIKey | OOOMPONPBZEKKG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |