C26H25N3OS — CID 69364961
N,N-dimethyl-3-[2-(13-thia-3,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),3,7,9,11,14,16-octaen-4-yl)phenoxy]propan-1-amine (PubChem CID 69364961) has the molecular formula C26H25N3OS and a molecular weight of 427.57 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-(13-thia-3,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),3,7,9,11,14,16-octaen-4-yl)phenoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[2-(13-thia-3,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),3,7,9,11,14,16-octaen-4-yl)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 69364961 |
| Molecular Formula | C26H25N3OS |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N,N-dimethyl-3-[2-(13-thia-3,5-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),3,7,9,11,14,16-octaen-4-yl)phenoxy]propan-1-amine |
| SMILES | CN(C)CCCOc1ccccc1-c1nc2c([nH]1)-c1ccccc1Sc1ccccc1-2 |
| InChI | InChI=1S/C26H25N3OS/c1-29(2)16-9-17-30-21-13-6-3-10-18(21)26-27-24-19-11-4-7-14-22(19)31-23-15-8-5-12-20(23)25(24)28-26/h3-8,10-15H,9,16-17H2,1-2H3,(H,27,28) |
| InChIKey | MFTZKSYWEYZEOF-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|