C23H23N3O3 — CID 69365932
[6-(cyanomethyl)-2-(2-methylpropyl)-1-oxo-4-phenylisoquinolin-3-yl]-methylcarbamic acid (PubChem CID 69365932) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is [6-(cyanomethyl)-2-(2-methylpropyl)-1-oxo-4-phenylisoquinolin-3-yl]-methylcarbamic acid.
| Compound Name | [6-(cyanomethyl)-2-(2-methylpropyl)-1-oxo-4-phenylisoquinolin-3-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 69365932 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [6-(cyanomethyl)-2-(2-methylpropyl)-1-oxo-4-phenylisoquinolin-3-yl]-methylcarbamic acid |
| SMILES | CC(C)Cn1c(N(C)C(=O)O)c(-c2ccccc2)c2cc(CC#N)ccc2c1=O |
| InChI | InChI=1S/C23H23N3O3/c1-15(2)14-26-21(25(3)23(28)29)20(17-7-5-4-6-8-17)19-13-16(11-12-24)9-10-18(19)22(26)27/h4-10,13,15H,11,14H2,1-3H3,(H,28,29) |
| InChIKey | GIONATYCGDBHQU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |