C25H26N6O2 — CID 69366201
[4-(2-pyridin-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)quinolin-7-yl] N-[3-(methylamino)propyl]carbamate (PubChem CID 69366201) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is [4-(2-pyridin-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)quinolin-7-yl] N-[3-(methylamino)propyl]carbamate.
| Compound Name | [4-(2-pyridin-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)quinolin-7-yl] N-[3-(methylamino)propyl]carbamate |
|---|---|
| PubChem CID | 69366201 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [4-(2-pyridin-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)quinolin-7-yl] N-[3-(methylamino)propyl]carbamate |
| SMILES | CNCCCNC(=O)Oc1ccc2c(-c3c(-c4ccccn4)nn4c3CCC4)ccnc2c1 |
| InChI | InChI=1S/C25H26N6O2/c1-26-11-5-13-29-25(32)33-17-8-9-18-19(10-14-28-21(18)16-17)23-22-7-4-15-31(22)30-24(23)20-6-2-3-12-27-20/h2-3,6,8-10,12,14,16,26H,4-5,7,11,13,15H2,1H3,(H,29,32) |
| InChIKey | XNGASGSKJRCREW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|