About 3H-imidazo[1,2-a]azepin-9-amine
3H-imidazo[1,2-a]azepin-9-amine (PubChem CID 69366373) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 3H-imidazo[1,2-a]azepin-9-amine.
Molecular Properties
| Compound Name | 3H-imidazo[1,2-a]azepin-9-amine |
| PubChem CID | 69366373 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 3H-imidazo[1,2-a]azepin-9-amine |
| SMILES | NC1=C2N=CCN2C=CC=C1 |
| InChI | InChI=1S/C8H9N3/c9-7-3-1-2-5-11-6-4-10-8(7)11/h1-5H,6,9H2 |
| InChIKey | AXZIFHDBTWHYCM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-imidazo[1,2-a]azepin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-imidazo[1,2-a]azepin-9-amine?
The IUPAC name of 3H-imidazo[1,2-a]azepin-9-amine (CID 69366373) is 3H-imidazo[1,2-a]azepin-9-amine.
What is the SMILES notation for 3H-imidazo[1,2-a]azepin-9-amine?
The canonical SMILES for 3H-imidazo[1,2-a]azepin-9-amine is NC1=C2N=CCN2C=CC=C1.
What is the InChIKey of 3H-imidazo[1,2-a]azepin-9-amine?
The InChIKey is AXZIFHDBTWHYCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c9-7-3-1-2-5-11-6-4-10-8(7)11/h1-5H,6,9H2.
What are the key properties of 3H-imidazo[1,2-a]azepin-9-amine?
3H-imidazo[1,2-a]azepin-9-amine has a molecular weight of 147.18 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-imidazo[1,2-a]azepin-9-amine is sourced from PubChem (CID 69366373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).