About tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate
tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate (PubChem CID 69366630) has the molecular formula C20H23F3N4O3
and a molecular weight of 424.42 g/mol. Its IUPAC name is tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate |
| PubChem CID | 69366630 |
| Molecular Formula | C20H23F3N4O3 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nccn(Cc3cc(F)c(F)cc3F)c2=O)CC1 |
| InChI | InChI=1S/C20H23F3N4O3/c1-20(2,3)30-19(29)26-8-6-25(7-9-26)17-18(28)27(5-4-24-17)12-13-10-15(22)16(23)11-14(13)21/h4-5,10-11H,6-9,12H2,1-3H3 |
| InChIKey | RJFHYLOATXVYEA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate (CID 69366630) is tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCN(c2nccn(Cc3cc(F)c(F)cc3F)c2=O)CC1.
What is the InChIKey of tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate?
The InChIKey is RJFHYLOATXVYEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F3N4O3/c1-20(2,3)30-19(29)26-8-6-25(7-9-26)17-18(28)27(5-4-24-17)12-13-10-15(22)16(23)11-14(13)21/h4-5,10-11H,6-9,12H2,1-3H3.
What are the key properties of tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate?
tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate has a molecular weight of 424.42 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[3-oxo-4-[(2,4,5-trifluorophenyl)methyl]pyrazin-2-yl]piperazine-1-carboxylate is sourced from PubChem (CID 69366630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).