4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid

C19H22N2O4 — CID 69366638

IUPAC4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid
SMILESCOc1ccc(OC)c(-c2ccc(N3CCN(C(=O)O)CC3)cc2)c1
InChIInChI=1S/C19H22N2O4/c1-24-16-7-8-18(25-2)17(13-16)14-3-5-15(6-4-14)20-9-11-21(12-10-20)19(22)23/h3-8,13H,9-12H2,1-2H3,(H,22,23)
InChIKeyOXTDJRGSZNNEBI-UHFFFAOYSA-N
MW342.40 g/mol
LogP3.17
Rot. Bonds4

About 4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid

4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid (PubChem CID 69366638) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid.

Molecular Properties

Compound Name4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid
PubChem CID69366638
Molecular FormulaC19H22N2O4
Molecular Weight342.40 g/mol
Exact Mass342.16
IUPAC Name4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid
SMILESCOc1ccc(OC)c(-c2ccc(N3CCN(C(=O)O)CC3)cc2)c1
InChIInChI=1S/C19H22N2O4/c1-24-16-7-8-18(25-2)17(13-16)14-3-5-15(6-4-14)20-9-11-21(12-10-20)19(22)23/h3-8,13H,9-12H2,1-2H3,(H,22,23)
InChIKeyOXTDJRGSZNNEBI-UHFFFAOYSA-N
XLogP3.17
TPSA62.24 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.40
LogP ≤ 53.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid?
The IUPAC name of 4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid (CID 69366638) is 4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid.
What is the SMILES notation for 4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid?
The canonical SMILES for 4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid is COc1ccc(OC)c(-c2ccc(N3CCN(C(=O)O)CC3)cc2)c1.
What is the InChIKey of 4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid?
The InChIKey is OXTDJRGSZNNEBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O4/c1-24-16-7-8-18(25-2)17(13-16)14-3-5-15(6-4-14)20-9-11-21(12-10-20)19(22)23/h3-8,13H,9-12H2,1-2H3,(H,22,23).
What are the key properties of 4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid?
4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid has a molecular weight of 342.40 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,5-dimethoxyphenyl)phenyl]piperazine-1-carboxylic acid is sourced from PubChem (CID 69366638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).