C12H17F6NO2 — CID 6936704
[(1S,2S)-2-methylcyclohexyl] N-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamate (PubChem CID 6936704) has the molecular formula C12H17F6NO2 and a molecular weight of 321.26 g/mol. Its IUPAC name is [(1S,2S)-2-methylcyclohexyl] N-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamate.
| Compound Name | [(1S,2S)-2-methylcyclohexyl] N-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamate |
|---|---|
| PubChem CID | 6936704 |
| Molecular Formula | C12H17F6NO2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | [(1S,2S)-2-methylcyclohexyl] N-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)carbamate |
| SMILES | C[C@H]1CCCC[C@@H]1OC(=O)NC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H17F6NO2/c1-7-5-3-4-6-8(7)21-9(20)19-10(2,11(13,14)15)12(16,17)18/h7-8H,3-6H2,1-2H3,(H,19,20)/t7-,8-/m0/s1 |
| InChIKey | JQKNIVJILBHMFB-YUMQZZPRSA-N |
| XLogP | 4.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |