About 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one
5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one (PubChem CID 69367641) has the molecular formula C18H20BrF2N3O3
and a molecular weight of 444.28 g/mol. Its IUPAC name is 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one.
Molecular Properties
| Compound Name | 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one |
| PubChem CID | 69367641 |
| Molecular Formula | C18H20BrF2N3O3 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one |
| SMILES | CC(C)n1c(N2CCOCC2)nc(OCc2ccc(F)cc2F)c(Br)c1=O |
| InChI | InChI=1S/C18H20BrF2N3O3/c1-11(2)24-17(25)15(19)16(22-18(24)23-5-7-26-8-6-23)27-10-12-3-4-13(20)9-14(12)21/h3-4,9,11H,5-8,10H2,1-2H3 |
| InChIKey | MWHRLCFJNFNBGL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one?
The IUPAC name of 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one (CID 69367641) is 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one.
What is the SMILES notation for 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one?
The canonical SMILES for 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one is CC(C)n1c(N2CCOCC2)nc(OCc2ccc(F)cc2F)c(Br)c1=O.
What is the InChIKey of 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one?
The InChIKey is MWHRLCFJNFNBGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20BrF2N3O3/c1-11(2)24-17(25)15(19)16(22-18(24)23-5-7-26-8-6-23)27-10-12-3-4-13(20)9-14(12)21/h3-4,9,11H,5-8,10H2,1-2H3.
What are the key properties of 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one?
5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one has a molecular weight of 444.28 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-[(2,4-difluorophenyl)methoxy]-2-morpholin-4-yl-3-propan-2-ylpyrimidin-4-one is sourced from PubChem (CID 69367641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).