About N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine
N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine (PubChem CID 69367734) has the molecular formula C20H26N4OSi
and a molecular weight of 366.54 g/mol. Its IUPAC name is N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine.
Molecular Properties
| Compound Name | N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine |
| PubChem CID | 69367734 |
| Molecular Formula | C20H26N4OSi |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine |
| SMILES | C#CNc1ccc2cnn(COCC[Si](C)(C)C)c2c1.c1ccncc1 |
| InChI | InChI=1S/C15H21N3OSi.C5H5N/c1-5-16-14-7-6-13-11-17-18(15(13)10-14)12-19-8-9-20(2,3)4;1-2-4-6-5-3-1/h1,6-7,10-11,16H,8-9,12H2,2-4H3;1-5H |
| InChIKey | RHDBXJZVERTVSM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine?
The IUPAC name of N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine (CID 69367734) is N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine.
What is the SMILES notation for N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine?
The canonical SMILES for N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine is C#CNc1ccc2cnn(COCC[Si](C)(C)C)c2c1.c1ccncc1.
What is the InChIKey of N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine?
The InChIKey is RHDBXJZVERTVSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3OSi.C5H5N/c1-5-16-14-7-6-13-11-17-18(15(13)10-14)12-19-8-9-20(2,3)4;1-2-4-6-5-3-1/h1,6-7,10-11,16H,8-9,12H2,2-4H3;1-5H.
What are the key properties of N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine?
N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine has a molecular weight of 366.54 g/mol, XLogP of 4.43, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethynyl-1-(2-trimethylsilylethoxymethyl)indazol-6-amine;pyridine is sourced from PubChem (CID 69367734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).