C19H24F3N9O — CID 69368453
5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 69368453) has the molecular formula C19H24F3N9O and a molecular weight of 451.46 g/mol. Its IUPAC name is 5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 69368453 |
| Molecular Formula | C19H24F3N9O |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | C[C@@H]1CN(c2nc(Nc3ccncn3)c3c(cnn3CCOCC(F)(F)F)n2)C[C@H](C)N1 |
| InChI | InChI=1S/C19H24F3N9O/c1-12-8-30(9-13(2)26-12)18-27-14-7-25-31(5-6-32-10-19(20,21)22)16(14)17(29-18)28-15-3-4-23-11-24-15/h3-4,7,11-13,26H,5-6,8-10H2,1-2H3,(H,23,24,27,28,29)/t12-,13+ |
| InChIKey | QZCKTAQFKXVNBU-BETUJISGSA-N |
| XLogP | 2.13 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|