About 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine
6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine (PubChem CID 69368662) has the molecular formula C6H6BrF2N
and a molecular weight of 210.02 g/mol. Its IUPAC name is 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine |
| PubChem CID | 69368662 |
| Molecular Formula | C6H6BrF2N |
| Molecular Weight | 210.02 g/mol |
| Exact Mass | 208.97 |
| IUPAC Name | 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine |
| SMILES | NC1C=CC(F)=CC1(F)Br |
| InChI | InChI=1S/C6H6BrF2N/c7-6(9)3-4(8)1-2-5(6)10/h1-3,5H,10H2 |
| InChIKey | IMKWGIONJWCDSV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.02 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine?
The IUPAC name of 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine (CID 69368662) is 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine?
The canonical SMILES for 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine is NC1C=CC(F)=CC1(F)Br.
What is the InChIKey of 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine?
The InChIKey is IMKWGIONJWCDSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrF2N/c7-6(9)3-4(8)1-2-5(6)10/h1-3,5H,10H2.
What are the key properties of 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine?
6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine has a molecular weight of 210.02 g/mol, XLogP of 1.80, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,6-difluorocyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 69368662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).