About 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate
1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 69369090) has the molecular formula C17H26O2
and a molecular weight of 262.39 g/mol. Its IUPAC name is 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
Molecular Properties
| Compound Name | 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| PubChem CID | 69369090 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(CC1CCCCC1)OC(=O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C17H26O2/c1-12(9-13-5-3-2-4-6-13)19-17(18)16-11-14-7-8-15(16)10-14/h7-8,12-16H,2-6,9-11H2,1H3 |
| InChIKey | PMPOIZFJJWLRRO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 69369090) is 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate is CC(CC1CCCCC1)OC(=O)C1CC2C=CC1C2.
What is the InChIKey of 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is PMPOIZFJJWLRRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O2/c1-12(9-13-5-3-2-4-6-13)19-17(18)16-11-14-7-8-15(16)10-14/h7-8,12-16H,2-6,9-11H2,1H3.
What are the key properties of 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 262.39 g/mol, XLogP of 4.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylpropan-2-yl bicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 69369090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).