About 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine
1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine (PubChem CID 69369351) has the molecular formula C10H11ClN2S
and a molecular weight of 226.73 g/mol. Its IUPAC name is 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine |
| PubChem CID | 69369351 |
| Molecular Formula | C10H11ClN2S |
| Molecular Weight | 226.73 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cc2nccc(Cl)c2s1 |
| InChI | InChI=1S/C10H11ClN2S/c1-13(2)6-7-5-9-10(14-7)8(11)3-4-12-9/h3-5H,6H2,1-2H3 |
| InChIKey | HLCSRMAYXHSUPK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine (CID 69369351) is 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine is CN(C)Cc1cc2nccc(Cl)c2s1.
What is the InChIKey of 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine?
The InChIKey is HLCSRMAYXHSUPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2S/c1-13(2)6-7-5-9-10(14-7)8(11)3-4-12-9/h3-5H,6H2,1-2H3.
What are the key properties of 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine?
1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine has a molecular weight of 226.73 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-chlorothieno[3,2-b]pyridin-2-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 69369351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).