C13H20N3O2S+ — CID 6936951
5-(furan-2-ylmethyl)-1-[[(2S)-oxolan-2-yl]methyl]-1,3,5-triazinan-5-ium-2-thione (PubChem CID 6936951) has the molecular formula C13H20N3O2S+ and a molecular weight of 282.39 g/mol. Its IUPAC name is 5-(furan-2-ylmethyl)-1-[[(2S)-oxolan-2-yl]methyl]-1,3,5-triazinan-5-ium-2-thione.
| Compound Name | 5-(furan-2-ylmethyl)-1-[[(2S)-oxolan-2-yl]methyl]-1,3,5-triazinan-5-ium-2-thione |
|---|---|
| PubChem CID | 6936951 |
| Molecular Formula | C13H20N3O2S+ |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 5-(furan-2-ylmethyl)-1-[[(2S)-oxolan-2-yl]methyl]-1,3,5-triazinan-5-ium-2-thione |
| SMILES | S=C1NC[NH+](Cc2ccco2)CN1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C13H19N3O2S/c19-13-14-9-15(7-11-3-1-5-17-11)10-16(13)8-12-4-2-6-18-12/h1,3,5,12H,2,4,6-10H2,(H,14,19)/p+1/t12-/m0/s1 |
| InChIKey | LVOBXMSCVGRHTC-LBPRGKRZSA-O |
| XLogP | -0.05 |
| TPSA | 42.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|