About 8-methyl-6H-thieno[2,3-f]quinolin-9-one
8-methyl-6H-thieno[2,3-f]quinolin-9-one (PubChem CID 69369663) has the molecular formula C12H9NOS
and a molecular weight of 215.28 g/mol. Its IUPAC name is 8-methyl-6H-thieno[2,3-f]quinolin-9-one.
Molecular Properties
| Compound Name | 8-methyl-6H-thieno[2,3-f]quinolin-9-one |
| PubChem CID | 69369663 |
| Molecular Formula | C12H9NOS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 8-methyl-6H-thieno[2,3-f]quinolin-9-one |
| SMILES | Cc1c[nH]c2ccc3ccsc3c2c1=O |
| InChI | InChI=1S/C12H9NOS/c1-7-6-13-9-3-2-8-4-5-15-12(8)10(9)11(7)14/h2-6H,1H3,(H,13,14) |
| InChIKey | GKMAHONHJXHXQV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-6H-thieno[2,3-f]quinolin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-6H-thieno[2,3-f]quinolin-9-one?
The IUPAC name of 8-methyl-6H-thieno[2,3-f]quinolin-9-one (CID 69369663) is 8-methyl-6H-thieno[2,3-f]quinolin-9-one.
What is the SMILES notation for 8-methyl-6H-thieno[2,3-f]quinolin-9-one?
The canonical SMILES for 8-methyl-6H-thieno[2,3-f]quinolin-9-one is Cc1c[nH]c2ccc3ccsc3c2c1=O.
What is the InChIKey of 8-methyl-6H-thieno[2,3-f]quinolin-9-one?
The InChIKey is GKMAHONHJXHXQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NOS/c1-7-6-13-9-3-2-8-4-5-15-12(8)10(9)11(7)14/h2-6H,1H3,(H,13,14).
What are the key properties of 8-methyl-6H-thieno[2,3-f]quinolin-9-one?
8-methyl-6H-thieno[2,3-f]quinolin-9-one has a molecular weight of 215.28 g/mol, XLogP of 3.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-6H-thieno[2,3-f]quinolin-9-one is sourced from PubChem (CID 69369663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).