C20H29N9O — CID 69369705
1-(2-ethoxyethyl)-5-[(3S)-3-ethylpiperazin-1-yl]-3-methyl-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 69369705) has the molecular formula C20H29N9O and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-5-[(3S)-3-ethylpiperazin-1-yl]-3-methyl-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 1-(2-ethoxyethyl)-5-[(3S)-3-ethylpiperazin-1-yl]-3-methyl-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 69369705 |
| Molecular Formula | C20H29N9O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 1-(2-ethoxyethyl)-5-[(3S)-3-ethylpiperazin-1-yl]-3-methyl-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCOCCn1nc(C)c2nc(N3CCN[C@@H](CC)C3)nc(Nc3ccncn3)c21 |
| InChI | InChI=1S/C20H29N9O/c1-4-15-12-28(9-8-22-15)20-25-17-14(3)27-29(10-11-30-5-2)18(17)19(26-20)24-16-6-7-21-13-23-16/h6-7,13,15,22H,4-5,8-12H2,1-3H3,(H,21,23,24,25,26)/t15-/m0/s1 |
| InChIKey | DTRZBKHVRONNBJ-HNNXBMFYSA-N |
| XLogP | 1.89 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|