C24H44O7 — CID 69369821
1-[(2S,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-4-yl]octadec-9-en-1-one (PubChem CID 69369821) has the molecular formula C24H44O7 and a molecular weight of 444.61 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-4-yl]octadec-9-en-1-one.
| Compound Name | 1-[(2S,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-4-yl]octadec-9-en-1-one |
|---|---|
| PubChem CID | 69369821 |
| Molecular Formula | C24H44O7 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 1-[(2S,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-4-yl]octadec-9-en-1-one |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)[C@]1(O)[C@H](O)[C@@H](CO)O[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H44O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(26)24(30)21(27)19(18-25)31-23(29)22(24)28/h9-10,19,21-23,25,27-30H,2-8,11-18H2,1H3/t19-,21-,22+,23+,24+/m1/s1 |
| InChIKey | PWIVBGHHVPYSHN-AZKGINQHSA-N |
| XLogP | 2.76 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|