C18H12FNO3S2 — CID 69370219
ethyl (9-fluoro-3,13-dithia-5-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7(12),8,10,14,16-octaen-4-yl) carbonate (PubChem CID 69370219) has the molecular formula C18H12FNO3S2 and a molecular weight of 373.43 g/mol. Its IUPAC name is ethyl (9-fluoro-3,13-dithia-5-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7(12),8,10,14,16-octaen-4-yl) carbonate.
| Compound Name | ethyl (9-fluoro-3,13-dithia-5-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7(12),8,10,14,16-octaen-4-yl) carbonate |
|---|---|
| PubChem CID | 69370219 |
| Molecular Formula | C18H12FNO3S2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | ethyl (9-fluoro-3,13-dithia-5-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7(12),8,10,14,16-octaen-4-yl) carbonate |
| SMILES | CCOC(=O)Oc1nc2c(s1)-c1ccccc1Sc1ccc(F)cc1-2 |
| InChI | InChI=1S/C18H12FNO3S2/c1-2-22-18(21)23-17-20-15-12-9-10(19)7-8-14(12)24-13-6-4-3-5-11(13)16(15)25-17/h3-9H,2H2,1H3 |
| InChIKey | LNOWUTCBHDPXPZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |