C12H15ClN2O2 — CID 69370527
8-(3-chloropropoxy)-1,3,4,5-tetrahydro-1,3-benzodiazepin-2-one (PubChem CID 69370527) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 8-(3-chloropropoxy)-1,3,4,5-tetrahydro-1,3-benzodiazepin-2-one.
| Compound Name | 8-(3-chloropropoxy)-1,3,4,5-tetrahydro-1,3-benzodiazepin-2-one |
|---|---|
| PubChem CID | 69370527 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 8-(3-chloropropoxy)-1,3,4,5-tetrahydro-1,3-benzodiazepin-2-one |
| SMILES | O=C1NCCc2ccc(OCCCCl)cc2N1 |
| InChI | InChI=1S/C12H15ClN2O2/c13-5-1-7-17-10-3-2-9-4-6-14-12(16)15-11(9)8-10/h2-3,8H,1,4-7H2,(H2,14,15,16) |
| InChIKey | WPVNYEJMFUDRKM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|