C21H27BrF2N2O3 — CID 69370936
tert-butyl N-[(2S,3S)-3-(4-bromophenyl)-1-(3,3-difluoropyrrolidin-1-yl)-1-oxohex-4-en-2-yl]carbamate (PubChem CID 69370936) has the molecular formula C21H27BrF2N2O3 and a molecular weight of 473.36 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-3-(4-bromophenyl)-1-(3,3-difluoropyrrolidin-1-yl)-1-oxohex-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-3-(4-bromophenyl)-1-(3,3-difluoropyrrolidin-1-yl)-1-oxohex-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 69370936 |
| Molecular Formula | C21H27BrF2N2O3 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | tert-butyl N-[(2S,3S)-3-(4-bromophenyl)-1-(3,3-difluoropyrrolidin-1-yl)-1-oxohex-4-en-2-yl]carbamate |
| SMILES | CC=C[C@@H](c1ccc(Br)cc1)[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C21H27BrF2N2O3/c1-5-6-16(14-7-9-15(22)10-8-14)17(25-19(28)29-20(2,3)4)18(27)26-12-11-21(23,24)13-26/h5-10,16-17H,11-13H2,1-4H3,(H,25,28)/t16-,17-/m0/s1 |
| InChIKey | WOYWQJUXDJSDBA-IRXDYDNUSA-N |
| XLogP | 4.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|