C25H30N2O2S — CID 69370992
3-(2,3-dihydro-1H-inden-2-yl)-6-pentan-3-yl-1-[(2-sulfanylphenyl)methyl]piperazine-2,5-dione (PubChem CID 69370992) has the molecular formula C25H30N2O2S and a molecular weight of 422.59 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-2-yl)-6-pentan-3-yl-1-[(2-sulfanylphenyl)methyl]piperazine-2,5-dione.
| Compound Name | 3-(2,3-dihydro-1H-inden-2-yl)-6-pentan-3-yl-1-[(2-sulfanylphenyl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 69370992 |
| Molecular Formula | C25H30N2O2S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-2-yl)-6-pentan-3-yl-1-[(2-sulfanylphenyl)methyl]piperazine-2,5-dione |
| SMILES | CCC(CC)C1C(=O)NC(C2Cc3ccccc3C2)C(=O)N1Cc1ccccc1S |
| InChI | InChI=1S/C25H30N2O2S/c1-3-16(4-2)23-24(28)26-22(20-13-17-9-5-6-10-18(17)14-20)25(29)27(23)15-19-11-7-8-12-21(19)30/h5-12,16,20,22-23,30H,3-4,13-15H2,1-2H3,(H,26,28) |
| InChIKey | VYBUPISATULQDH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|