C25H38BFN2O5 — CID 69371253
tert-butyl N-[(2S,3S)-1-[(3S)-3-fluoropyrrolidin-1-yl]-1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamate (PubChem CID 69371253) has the molecular formula C25H38BFN2O5 and a molecular weight of 476.40 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-1-[(3S)-3-fluoropyrrolidin-1-yl]-1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-1-[(3S)-3-fluoropyrrolidin-1-yl]-1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 69371253 |
| Molecular Formula | C25H38BFN2O5 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | tert-butyl N-[(2S,3S)-1-[(3S)-3-fluoropyrrolidin-1-yl]-1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamate |
| SMILES | C[C@@H](c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@H](F)C1 |
| InChI | InChI=1S/C25H38BFN2O5/c1-16(17-9-11-18(12-10-17)26-33-24(5,6)25(7,8)34-26)20(28-22(31)32-23(2,3)4)21(30)29-14-13-19(27)15-29/h9-12,16,19-20H,13-15H2,1-8H3,(H,28,31)/t16-,19-,20-/m0/s1 |
| InChIKey | UGUYIENFGQSMIK-VDGAXYAQSA-N |
| XLogP | 3.55 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|