C16H19NO6 — CID 69371257
4-[4-[(2-methoxy-2-oxoacetyl)amino]phenoxy]cyclohexane-1-carboxylic acid (PubChem CID 69371257) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is 4-[4-[(2-methoxy-2-oxoacetyl)amino]phenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[(2-methoxy-2-oxoacetyl)amino]phenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 69371257 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-[4-[(2-methoxy-2-oxoacetyl)amino]phenoxy]cyclohexane-1-carboxylic acid |
| SMILES | COC(=O)C(=O)Nc1ccc(OC2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C16H19NO6/c1-22-16(21)14(18)17-11-4-8-13(9-5-11)23-12-6-2-10(3-7-12)15(19)20/h4-5,8-10,12H,2-3,6-7H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | ZTFUVWRHWGUQRI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|