C25H41N9O2Si — CID 69371350
3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(2-ethoxyethyl)-5-[(3R)-3-methylpiperazin-1-yl]-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 69371350) has the molecular formula C25H41N9O2Si and a molecular weight of 527.75 g/mol. Its IUPAC name is 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(2-ethoxyethyl)-5-[(3R)-3-methylpiperazin-1-yl]-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(2-ethoxyethyl)-5-[(3R)-3-methylpiperazin-1-yl]-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 69371350 |
| Molecular Formula | C25H41N9O2Si |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(2-ethoxyethyl)-5-[(3R)-3-methylpiperazin-1-yl]-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCOCCn1nc(CO[Si](C)(C)C(C)(C)C)c2nc(N3CCN[C@H](C)C3)nc(Nc3ccncn3)c21 |
| InChI | InChI=1S/C25H41N9O2Si/c1-8-35-14-13-34-22-21(19(32-34)16-36-37(6,7)25(3,4)5)30-24(33-12-11-27-18(2)15-33)31-23(22)29-20-9-10-26-17-28-20/h9-10,17-18,27H,8,11-16H2,1-7H3,(H,26,28,29,30,31)/t18-/m1/s1 |
| InChIKey | SUBWODCNZCGNQM-GOSISDBHSA-N |
| XLogP | 3.72 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|