About [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate
[3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 69371366) has the molecular formula C27H30N2O3
and a molecular weight of 430.55 g/mol. Its IUPAC name is [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate.
Molecular Properties
| Compound Name | [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate |
| PubChem CID | 69371366 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(OCC(C[C@H]1CCCNC1)c1ccccn1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O3/c30-26(27(31,23-11-3-1-4-12-23)24-13-5-2-6-14-24)32-20-22(25-15-7-8-17-29-25)18-21-10-9-16-28-19-21/h1-8,11-15,17,21-22,28,31H,9-10,16,18-20H2/t21-,22?/m1/s1 |
| InChIKey | AEMXHXCMHNMZDP-ZMFCMNQTSA-N |
| XLogP | 4.03 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate?
The IUPAC name of [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate (CID 69371366) is [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate.
What is the SMILES notation for [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate?
The canonical SMILES for [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate is O=C(OCC(C[C@H]1CCCNC1)c1ccccn1)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate?
The InChIKey is AEMXHXCMHNMZDP-ZMFCMNQTSA-N. The full InChI is InChI=1S/C27H30N2O3/c30-26(27(31,23-11-3-1-4-12-23)24-13-5-2-6-14-24)32-20-22(25-15-7-8-17-29-25)18-21-10-9-16-28-19-21/h1-8,11-15,17,21-22,28,31H,9-10,16,18-20H2/t21-,22?/m1/s1.
What are the key properties of [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate?
[3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate has a molecular weight of 430.55 g/mol, XLogP of 4.03, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3R)-piperidin-3-yl]-2-pyridin-2-ylpropyl] 2-hydroxy-2,2-diphenylacetate is sourced from PubChem (CID 69371366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).