About 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole
1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole (PubChem CID 69371814) has the molecular formula C28H23N5O
and a molecular weight of 445.53 g/mol. Its IUPAC name is 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole.
Molecular Properties
| Compound Name | 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole |
| PubChem CID | 69371814 |
| Molecular Formula | C28H23N5O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole |
| SMILES | COc1ccc(-c2ccc3c(/C=C/c4ccccc4)n[nH]c3c2)cn1.c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C21H17N3O.C7H6N2/c1-25-21-12-9-17(14-22-21)16-8-10-18-19(23-24-20(18)13-16)11-7-15-5-3-2-4-6-15;1-2-4-7-6(3-1)5-8-9-7/h2-14H,1H3,(H,23,24);1-5H,(H,8,9)/b11-7+; |
| InChIKey | GFQSTAVDADLGFU-RVDQCCQOSA-N |
| XLogP | 6.37 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole?
The IUPAC name of 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole (CID 69371814) is 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole.
What is the SMILES notation for 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole?
The canonical SMILES for 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole is COc1ccc(-c2ccc3c(/C=C/c4ccccc4)n[nH]c3c2)cn1.c1ccc2[nH]ncc2c1.
What is the InChIKey of 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole?
The InChIKey is GFQSTAVDADLGFU-RVDQCCQOSA-N. The full InChI is InChI=1S/C21H17N3O.C7H6N2/c1-25-21-12-9-17(14-22-21)16-8-10-18-19(23-24-20(18)13-16)11-7-15-5-3-2-4-6-15;1-2-4-7-6(3-1)5-8-9-7/h2-14H,1H3,(H,23,24);1-5H,(H,8,9)/b11-7+;.
What are the key properties of 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole?
1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole has a molecular weight of 445.53 g/mol, XLogP of 6.37, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole;6-(6-methoxy-3-pyridinyl)-3-[(E)-2-phenylethenyl]-1H-indazole is sourced from PubChem (CID 69371814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).