C20H22ClN2O+ — CID 6937237
(3R,4S)-6-chloro-4-phenyl-3-piperidin-1-ium-1-yl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 6937237) has the molecular formula C20H22ClN2O+ and a molecular weight of 341.86 g/mol. Its IUPAC name is (3R,4S)-6-chloro-4-phenyl-3-piperidin-1-ium-1-yl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | (3R,4S)-6-chloro-4-phenyl-3-piperidin-1-ium-1-yl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 6937237 |
| Molecular Formula | C20H22ClN2O+ |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (3R,4S)-6-chloro-4-phenyl-3-piperidin-1-ium-1-yl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2[C@H](c2ccccc2)[C@H]1[NH+]1CCCCC1 |
| InChI | InChI=1S/C20H21ClN2O/c21-15-9-10-17-16(13-15)18(14-7-3-1-4-8-14)19(20(24)22-17)23-11-5-2-6-12-23/h1,3-4,7-10,13,18-19H,2,5-6,11-12H2,(H,22,24)/p+1/t18-,19+/m0/s1 |
| InChIKey | RFJOHFMXEIPMJX-RBUKOAKNSA-O |
| XLogP | 2.86 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |