About 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione
3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione (PubChem CID 69373508) has the molecular formula C22H18N4O2
and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione |
| PubChem CID | 69373508 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione |
| SMILES | CC(C)n1cc(C2=C(c3cnc4ccccn34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C22H18N4O2/c1-13(2)26-12-15(14-7-3-4-8-16(14)26)19-20(22(28)24-21(19)27)17-11-23-18-9-5-6-10-25(17)18/h3-13H,1-2H3,(H,24,27,28) |
| InChIKey | WBDBZULPYMAVTJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione?
The IUPAC name of 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione (CID 69373508) is 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione.
What is the SMILES notation for 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione?
The canonical SMILES for 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione is CC(C)n1cc(C2=C(c3cnc4ccccn34)C(=O)NC2=O)c2ccccc21.
What is the InChIKey of 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione?
The InChIKey is WBDBZULPYMAVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N4O2/c1-13(2)26-12-15(14-7-3-4-8-16(14)26)19-20(22(28)24-21(19)27)17-11-23-18-9-5-6-10-25(17)18/h3-13H,1-2H3,(H,24,27,28).
What are the key properties of 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione?
3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione has a molecular weight of 370.41 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[1,2-a]pyridin-3-yl-4-(1-propan-2-ylindol-3-yl)pyrrole-2,5-dione is sourced from PubChem (CID 69373508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).