methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid

C5H8N2O4 — CID 69373611

IUPACmethyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid
SMILESCN(C(=O)O)C1CNC(=O)O1
InChIInChI=1S/C5H8N2O4/c1-7(5(9)10)3-2-6-4(8)11-3/h3H,2H2,1H3,(H,6,8)(H,9,10)
InChIKeyVLPFZASKQOXNEV-UHFFFAOYSA-N
MW160.13 g/mol
LogP-0.34
Rot. Bonds1

About methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid

methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid (PubChem CID 69373611) has the molecular formula C5H8N2O4 and a molecular weight of 160.13 g/mol. Its IUPAC name is methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid.

Molecular Properties

Compound Namemethyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid
PubChem CID69373611
Molecular FormulaC5H8N2O4
Molecular Weight160.13 g/mol
Exact Mass160.05
IUPAC Namemethyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid
SMILESCN(C(=O)O)C1CNC(=O)O1
InChIInChI=1S/C5H8N2O4/c1-7(5(9)10)3-2-6-4(8)11-3/h3H,2H2,1H3,(H,6,8)(H,9,10)
InChIKeyVLPFZASKQOXNEV-UHFFFAOYSA-N
XLogP-0.34
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.13
LogP ≤ 5-0.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid?
The IUPAC name of methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid (CID 69373611) is methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid.
What is the SMILES notation for methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid?
The canonical SMILES for methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid is CN(C(=O)O)C1CNC(=O)O1.
What is the InChIKey of methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid?
The InChIKey is VLPFZASKQOXNEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O4/c1-7(5(9)10)3-2-6-4(8)11-3/h3H,2H2,1H3,(H,6,8)(H,9,10).
What are the key properties of methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid?
methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid has a molecular weight of 160.13 g/mol, XLogP of -0.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(2-oxo-1,3-oxazolidin-5-yl)carbamic acid is sourced from PubChem (CID 69373611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).