C11H10N2O6S — CID 69373668
10-oxo-11-sulfo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylic acid (PubChem CID 69373668) has the molecular formula C11H10N2O6S and a molecular weight of 298.28 g/mol. Its IUPAC name is 10-oxo-11-sulfo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylic acid.
| Compound Name | 10-oxo-11-sulfo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylic acid |
|---|---|
| PubChem CID | 69373668 |
| Molecular Formula | C11H10N2O6S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 10-oxo-11-sulfo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylic acid |
| SMILES | O=C(O)C1c2ccccc2C2CN1C(=O)N2S(=O)(=O)O |
| InChI | InChI=1S/C11H10N2O6S/c14-10(15)9-7-4-2-1-3-6(7)8-5-12(9)11(16)13(8)20(17,18)19/h1-4,8-9H,5H2,(H,14,15)(H,17,18,19) |
| InChIKey | JNYOWLHSKSMLJU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|