About 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine
2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine (PubChem CID 69373695) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 69373695 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine |
| SMILES | NC1=C(C2=COC=CO2)CCC=C1 |
| InChI | InChI=1S/C10H11NO2/c11-9-4-2-1-3-8(9)10-7-12-5-6-13-10/h2,4-7H,1,3,11H2 |
| InChIKey | XWKMSQFRIPSTDT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine?
The IUPAC name of 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine (CID 69373695) is 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine is NC1=C(C2=COC=CO2)CCC=C1.
What is the InChIKey of 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine?
The InChIKey is XWKMSQFRIPSTDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c11-9-4-2-1-3-8(9)10-7-12-5-6-13-10/h2,4-7H,1,3,11H2.
What are the key properties of 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine?
2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine has a molecular weight of 177.20 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dioxin-2-yl)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 69373695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).