C28H25N5O4 — CID 69374513
3-[5-[[2-[4-(3-hydroxy-2-oxopyrrolidin-1-yl)phenyl]acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide (PubChem CID 69374513) has the molecular formula C28H25N5O4 and a molecular weight of 495.54 g/mol. Its IUPAC name is 3-[5-[[2-[4-(3-hydroxy-2-oxopyrrolidin-1-yl)phenyl]acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide.
| Compound Name | 3-[5-[[2-[4-(3-hydroxy-2-oxopyrrolidin-1-yl)phenyl]acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 69374513 |
| Molecular Formula | C28H25N5O4 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 3-[5-[[2-[4-(3-hydroxy-2-oxopyrrolidin-1-yl)phenyl]acetyl]amino]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-phenylprop-2-enamide |
| SMILES | NC(=O)C(=Cc1c[nH]c2ncc(NC(=O)Cc3ccc(N4CCC(O)C4=O)cc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C28H25N5O4/c29-26(36)22(18-4-2-1-3-5-18)13-19-15-30-27-23(19)14-20(16-31-27)32-25(35)12-17-6-8-21(9-7-17)33-11-10-24(34)28(33)37/h1-9,13-16,24,34H,10-12H2,(H2,29,36)(H,30,31)(H,32,35) |
| InChIKey | IWWKVSQXQYGTSX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|