About methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate
methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate (PubChem CID 69374815) has the molecular formula C19H18N4O4
and a molecular weight of 366.38 g/mol. Its IUPAC name is methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate |
| PubChem CID | 69374815 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1.COC(=O)c1cccnc1Nc1ccccn1 |
| InChI | InChI=1S/C12H11N3O2.C7H7NO2/c1-17-12(16)9-5-4-8-14-11(9)15-10-6-2-3-7-13-10;1-10-7(9)6-3-2-4-8-5-6/h2-8H,1H3,(H,13,14,15);2-5H,1H3 |
| InChIKey | XYZHSLNJBXTHGG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate?
The IUPAC name of methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate (CID 69374815) is methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate.
What is the SMILES notation for methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate?
The canonical SMILES for methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate is COC(=O)c1cccnc1.COC(=O)c1cccnc1Nc1ccccn1.
What is the InChIKey of methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate?
The InChIKey is XYZHSLNJBXTHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2.C7H7NO2/c1-17-12(16)9-5-4-8-14-11(9)15-10-6-2-3-7-13-10;1-10-7(9)6-3-2-4-8-5-6/h2-8H,1H3,(H,13,14,15);2-5H,1H3.
What are the key properties of methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate?
methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate has a molecular weight of 366.38 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl pyridine-3-carboxylate;methyl 2-(pyridin-2-ylamino)pyridine-3-carboxylate is sourced from PubChem (CID 69374815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).